C18H20FN7O — CID 11566868
2-[[4-(3-aminoanilino)-6-[(2-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]ethanol (PubChem CID 11566868) has the molecular formula C18H20FN7O and a molecular weight of 369.40 g/mol. Its IUPAC name is 2-[[4-(3-aminoanilino)-6-[(2-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]ethanol.
| Compound Name | 2-[[4-(3-aminoanilino)-6-[(2-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]ethanol |
|---|---|
| PubChem CID | 11566868 |
| Molecular Formula | C18H20FN7O |
| Molecular Weight | 369.40 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-[[4-(3-aminoanilino)-6-[(2-fluorophenyl)methylamino]-1,3,5-triazin-2-yl]amino]ethanol |
| SMILES | Nc1cccc(Nc2nc(NCCO)nc(NCc3ccccc3F)n2)c1 |
| InChI | InChI=1S/C18H20FN7O/c19-15-7-2-1-4-12(15)11-22-17-24-16(21-8-9-27)25-18(26-17)23-14-6-3-5-13(20)10-14/h1-7,10,27H,8-9,11,20H2,(H3,21,22,23,24,25,26) |
| InChIKey | GKDOWIZAPFVGLU-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 121.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.40 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|