C22H28FN7O2 — CID 23901092
6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-[(2-fluorophenyl)methyl]-2-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 23901092) has the molecular formula C22H28FN7O2 and a molecular weight of 441.51 g/mol. Its IUPAC name is 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-[(2-fluorophenyl)methyl]-2-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-[(2-fluorophenyl)methyl]-2-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23901092 |
| Molecular Formula | C22H28FN7O2 |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-[(2-fluorophenyl)methyl]-2-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | NCCOCCOCCNc1nc(NCc2ccccc2F)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C22H28FN7O2/c23-19-9-5-4-6-17(19)16-26-21-28-20(25-11-13-32-15-14-31-12-10-24)29-22(30-21)27-18-7-2-1-3-8-18/h1-9H,10-16,24H2,(H3,25,26,27,28,29,30) |
| InChIKey | ARDLUFVQHGVTTC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|