C23H31N7O2 — CID 23984724
6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-[(4-methylphenyl)methyl]-2-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 23984724) has the molecular formula C23H31N7O2 and a molecular weight of 437.55 g/mol. Its IUPAC name is 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-[(4-methylphenyl)methyl]-2-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-[(4-methylphenyl)methyl]-2-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23984724 |
| Molecular Formula | C23H31N7O2 |
| Molecular Weight | 437.55 g/mol |
| Exact Mass | 437.25 |
| IUPAC Name | 6-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-N-[(4-methylphenyl)methyl]-2-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | Cc1ccc(CNc2nc(NCCOCCOCCN)nc(Nc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C23H31N7O2/c1-18-7-9-19(10-8-18)17-26-22-28-21(25-12-14-32-16-15-31-13-11-24)29-23(30-22)27-20-5-3-2-4-6-20/h2-10H,11-17,24H2,1H3,(H3,25,26,27,28,29,30) |
| InChIKey | OCNNBHVNVBQPIS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 119.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.55 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|