C31H38N8O3 — CID 23956545
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4,6-bis(benzylamino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 23956545) has the molecular formula C31H38N8O3 and a molecular weight of 570.70 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4,6-bis(benzylamino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4,6-bis(benzylamino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 23956545 |
| Molecular Formula | C31H38N8O3 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.31 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4,6-bis(benzylamino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | NCCOCCOCCNC(=O)Cc1ccc(Nc2nc(NCc3ccccc3)nc(NCc3ccccc3)n2)cc1 |
| InChI | InChI=1S/C31H38N8O3/c32-15-17-41-19-20-42-18-16-33-28(40)21-24-11-13-27(14-12-24)36-31-38-29(34-22-25-7-3-1-4-8-25)37-30(39-31)35-23-26-9-5-2-6-10-26/h1-14H,15-23,32H2,(H,33,40)(H3,34,35,36,37,38,39) |
| InChIKey | IWGLQFLBLVTFQP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|