C23H36N8O4 — CID 23984367
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4-(3-hydroxypropylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 23984367) has the molecular formula C23H36N8O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4-(3-hydroxypropylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4-(3-hydroxypropylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 23984367 |
| Molecular Formula | C23H36N8O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.29 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4-(3-hydroxypropylamino)-6-(prop-2-enylamino)-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | C=CCNc1nc(NCCCO)nc(Nc2ccc(CC(=O)NCCOCCOCCN)cc2)n1 |
| InChI | InChI=1S/C23H36N8O4/c1-2-9-26-21-29-22(27-10-3-12-32)31-23(30-21)28-19-6-4-18(5-7-19)17-20(33)25-11-14-35-16-15-34-13-8-24/h2,4-7,32H,1,3,8-17,24H2,(H,25,33)(H3,26,27,28,29,30,31) |
| InChIKey | YEQPZWFEQMODBH-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 168.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|