C30H42N8O4 — CID 23928802
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4-(butylamino)-6-[2-(4-formylphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]phenyl]acetamide (PubChem CID 23928802) has the molecular formula C30H42N8O4 and a molecular weight of 578.72 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4-(butylamino)-6-[2-(4-formylphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]phenyl]acetamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4-(butylamino)-6-[2-(4-formylphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 23928802 |
| Molecular Formula | C30H42N8O4 |
| Molecular Weight | 578.72 g/mol |
| Exact Mass | 578.33 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-2-[4-[[4-(butylamino)-6-[2-(4-formylphenyl)ethylamino]-1,3,5-triazin-2-yl]amino]phenyl]acetamide |
| SMILES | CCCCNc1nc(NCCc2ccc(C=O)cc2)nc(Nc2ccc(CC(=O)NCCOCCOCCN)cc2)n1 |
| InChI | InChI=1S/C30H42N8O4/c1-2-3-14-33-28-36-29(34-15-12-23-4-6-25(22-39)7-5-23)38-30(37-28)35-26-10-8-24(9-11-26)21-27(40)32-16-18-42-20-19-41-17-13-31/h4-11,22H,2-3,12-21,31H2,1H3,(H,32,40)(H3,33,34,35,36,37,38) |
| InChIKey | SBDZFTBNVPXFMI-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 165.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.72 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|