C25H42N8O3 — CID 23787433
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4-(butylamino)-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]benzamide (PubChem CID 23787433) has the molecular formula C25H42N8O3 and a molecular weight of 502.66 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4-(butylamino)-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]benzamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4-(butylamino)-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]benzamide |
|---|---|
| PubChem CID | 23787433 |
| Molecular Formula | C25H42N8O3 |
| Molecular Weight | 502.66 g/mol |
| Exact Mass | 502.34 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-4-[[4-(butylamino)-6-(pentan-3-ylamino)-1,3,5-triazin-2-yl]amino]benzamide |
| SMILES | CCCCNc1nc(Nc2ccc(C(=O)NCCOCCOCCN)cc2)nc(NC(CC)CC)n1 |
| InChI | InChI=1S/C25H42N8O3/c1-4-7-13-28-23-31-24(29-20(5-2)6-3)33-25(32-23)30-21-10-8-19(9-11-21)22(34)27-14-16-36-18-17-35-15-12-26/h8-11,20H,4-7,12-18,26H2,1-3H3,(H,27,34)(H3,28,29,30,31,32,33) |
| InChIKey | GYLWVJFJLXWUAD-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 148.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|