C19H24N8O — CID 11567086
6-N-(2-aminoethyl)-2-N-(3-aminophenyl)-4-N-[(4-methoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 11567086) has the molecular formula C19H24N8O and a molecular weight of 380.46 g/mol. Its IUPAC name is 6-N-(2-aminoethyl)-2-N-(3-aminophenyl)-4-N-[(4-methoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-(2-aminoethyl)-2-N-(3-aminophenyl)-4-N-[(4-methoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 11567086 |
| Molecular Formula | C19H24N8O |
| Molecular Weight | 380.46 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 6-N-(2-aminoethyl)-2-N-(3-aminophenyl)-4-N-[(4-methoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | COc1ccc(CNc2nc(NCCN)nc(Nc3cccc(N)c3)n2)cc1 |
| InChI | InChI=1S/C19H24N8O/c1-28-16-7-5-13(6-8-16)12-23-18-25-17(22-10-9-20)26-19(27-18)24-15-4-2-3-14(21)11-15/h2-8,11H,9-10,12,20-21H2,1H3,(H3,22,23,24,25,26,27) |
| InChIKey | LRZGRUHDZIJNCY-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 136.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|