C19H23N7O2 — CID 134108535
N-[4-[[4-(aminomethyl)phenyl]methylamino]-6-[(3-methoxyphenyl)methylamino]-1,3,5-triazin-2-yl]hydroxylamine (PubChem CID 134108535) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[4-[[4-(aminomethyl)phenyl]methylamino]-6-[(3-methoxyphenyl)methylamino]-1,3,5-triazin-2-yl]hydroxylamine.
| Compound Name | N-[4-[[4-(aminomethyl)phenyl]methylamino]-6-[(3-methoxyphenyl)methylamino]-1,3,5-triazin-2-yl]hydroxylamine |
|---|---|
| PubChem CID | 134108535 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[4-[[4-(aminomethyl)phenyl]methylamino]-6-[(3-methoxyphenyl)methylamino]-1,3,5-triazin-2-yl]hydroxylamine |
| SMILES | COc1cccc(CNc2nc(NO)nc(NCc3ccc(CN)cc3)n2)c1 |
| InChI | InChI=1S/C19H23N7O2/c1-28-16-4-2-3-15(9-16)12-22-18-23-17(24-19(25-18)26-27)21-11-14-7-5-13(10-20)6-8-14/h2-9,27H,10-12,20H2,1H3,(H3,21,22,23,24,25,26) |
| InChIKey | LSAVENFXODQOPW-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|