C20H23IN4O2 — CID 138683371
5-iodo-N-[(4-methoxyphenyl)methyl]pyrimidin-2-amine;(4-methoxyphenyl)methanamine (PubChem CID 138683371) has the molecular formula C20H23IN4O2 and a molecular weight of 478.33 g/mol. Its IUPAC name is 5-iodo-N-[(4-methoxyphenyl)methyl]pyrimidin-2-amine;(4-methoxyphenyl)methanamine.
| Compound Name | 5-iodo-N-[(4-methoxyphenyl)methyl]pyrimidin-2-amine;(4-methoxyphenyl)methanamine |
|---|---|
| PubChem CID | 138683371 |
| Molecular Formula | C20H23IN4O2 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 5-iodo-N-[(4-methoxyphenyl)methyl]pyrimidin-2-amine;(4-methoxyphenyl)methanamine |
| SMILES | COc1ccc(CN)cc1.COc1ccc(CNc2ncc(I)cn2)cc1 |
| InChI | InChI=1S/C12H12IN3O.C8H11NO/c1-17-11-4-2-9(3-5-11)6-14-12-15-7-10(13)8-16-12;1-10-8-4-2-7(6-9)3-5-8/h2-5,7-8H,6H2,1H3,(H,14,15,16);2-5H,6,9H2,1H3 |
| InChIKey | YWZDWLOAXZUDHC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|