C12H13IN4 — CID 116648248
N-[[3-(aminomethyl)phenyl]methyl]-5-iodopyrimidin-2-amine (PubChem CID 116648248) has the molecular formula C12H13IN4 and a molecular weight of 340.17 g/mol. Its IUPAC name is N-[[3-(aminomethyl)phenyl]methyl]-5-iodopyrimidin-2-amine.
| Compound Name | N-[[3-(aminomethyl)phenyl]methyl]-5-iodopyrimidin-2-amine |
|---|---|
| PubChem CID | 116648248 |
| Molecular Formula | C12H13IN4 |
| Molecular Weight | 340.17 g/mol |
| Exact Mass | 340.02 |
| IUPAC Name | N-[[3-(aminomethyl)phenyl]methyl]-5-iodopyrimidin-2-amine |
| SMILES | NCc1cccc(CNc2ncc(I)cn2)c1 |
| InChI | InChI=1S/C12H13IN4/c13-11-7-16-12(17-8-11)15-6-10-3-1-2-9(4-10)5-14/h1-4,7-8H,5-6,14H2,(H,15,16,17) |
| InChIKey | XABVESNCGNNGGB-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|