C11H11FN4 — CID 104606455
N-[(3-aminophenyl)methyl]-5-fluoropyrimidin-2-amine (PubChem CID 104606455) has the molecular formula C11H11FN4 and a molecular weight of 218.24 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-5-fluoropyrimidin-2-amine.
| Compound Name | N-[(3-aminophenyl)methyl]-5-fluoropyrimidin-2-amine |
|---|---|
| PubChem CID | 104606455 |
| Molecular Formula | C11H11FN4 |
| Molecular Weight | 218.24 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-5-fluoropyrimidin-2-amine |
| SMILES | Nc1cccc(CNc2ncc(F)cn2)c1 |
| InChI | InChI=1S/C11H11FN4/c12-9-6-15-11(16-7-9)14-5-8-2-1-3-10(13)4-8/h1-4,6-7H,5,13H2,(H,14,15,16) |
| InChIKey | LDTZMVDYUFWRGW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|