C11H11Cl3N4 — CID 87400674
N-[(3-aminophenyl)methyl]-2,5-dichloropyrimidin-4-amine;hydron;chloride (PubChem CID 87400674) has the molecular formula C11H11Cl3N4 and a molecular weight of 305.60 g/mol. Its IUPAC name is N-[(3-aminophenyl)methyl]-2,5-dichloropyrimidin-4-amine;hydron;chloride.
| Compound Name | N-[(3-aminophenyl)methyl]-2,5-dichloropyrimidin-4-amine;hydron;chloride |
|---|---|
| PubChem CID | 87400674 |
| Molecular Formula | C11H11Cl3N4 |
| Molecular Weight | 305.60 g/mol |
| Exact Mass | 304.00 |
| IUPAC Name | N-[(3-aminophenyl)methyl]-2,5-dichloropyrimidin-4-amine;hydron;chloride |
| SMILES | Nc1cccc(CNc2nc(Cl)ncc2Cl)c1.[Cl-].[H+] |
| InChI | InChI=1S/C11H10Cl2N4.ClH/c12-9-6-16-11(13)17-10(9)15-5-7-2-1-3-8(14)4-7;/h1-4,6H,5,14H2,(H,15,16,17);1H |
| InChIKey | AQHCKDVQKVGDRY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.60 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|