C12H8Cl2N4 — CID 79632815
4-[[(2,5-dichloropyrimidin-4-yl)amino]methyl]benzonitrile (PubChem CID 79632815) has the molecular formula C12H8Cl2N4 and a molecular weight of 279.13 g/mol. Its IUPAC name is 4-[[(2,5-dichloropyrimidin-4-yl)amino]methyl]benzonitrile.
| Compound Name | 4-[[(2,5-dichloropyrimidin-4-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 79632815 |
| Molecular Formula | C12H8Cl2N4 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 278.01 |
| IUPAC Name | 4-[[(2,5-dichloropyrimidin-4-yl)amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2nc(Cl)ncc2Cl)cc1 |
| InChI | InChI=1S/C12H8Cl2N4/c13-10-7-17-12(14)18-11(10)16-6-9-3-1-8(5-15)2-4-9/h1-4,7H,6H2,(H,16,17,18) |
| InChIKey | JTSRGDDWTHENEK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |