C12H11N5 — CID 113228938
4-[[(3-aminopyrazin-2-yl)amino]methyl]benzonitrile (PubChem CID 113228938) has the molecular formula C12H11N5 and a molecular weight of 225.25 g/mol. Its IUPAC name is 4-[[(3-aminopyrazin-2-yl)amino]methyl]benzonitrile.
| Compound Name | 4-[[(3-aminopyrazin-2-yl)amino]methyl]benzonitrile |
|---|---|
| PubChem CID | 113228938 |
| Molecular Formula | C12H11N5 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 4-[[(3-aminopyrazin-2-yl)amino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNc2nccnc2N)cc1 |
| InChI | InChI=1S/C12H11N5/c13-7-9-1-3-10(4-2-9)8-17-12-11(14)15-5-6-16-12/h1-6H,8H2,(H2,14,15)(H,16,17) |
| InChIKey | IAKXKVBLRPXOTQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |