C11H8BrCl2N3 — CID 79632289
N-[(3-bromophenyl)methyl]-2,5-dichloropyrimidin-4-amine (PubChem CID 79632289) has the molecular formula C11H8BrCl2N3 and a molecular weight of 333.02 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-2,5-dichloropyrimidin-4-amine.
| Compound Name | N-[(3-bromophenyl)methyl]-2,5-dichloropyrimidin-4-amine |
|---|---|
| PubChem CID | 79632289 |
| Molecular Formula | C11H8BrCl2N3 |
| Molecular Weight | 333.02 g/mol |
| Exact Mass | 330.93 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-2,5-dichloropyrimidin-4-amine |
| SMILES | Clc1ncc(Cl)c(NCc2cccc(Br)c2)n1 |
| InChI | InChI=1S/C11H8BrCl2N3/c12-8-3-1-2-7(4-8)5-15-10-9(13)6-16-11(14)17-10/h1-4,6H,5H2,(H,15,16,17) |
| InChIKey | SBJLZGPWJZYOGN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.02 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |