C14H12ClN5 — CID 59627820
2-chloro-4-N-(quinolin-6-ylmethyl)pyrimidine-4,5-diamine (PubChem CID 59627820) has the molecular formula C14H12ClN5 and a molecular weight of 285.74 g/mol. Its IUPAC name is 2-chloro-4-N-(quinolin-6-ylmethyl)pyrimidine-4,5-diamine.
| Compound Name | 2-chloro-4-N-(quinolin-6-ylmethyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 59627820 |
| Molecular Formula | C14H12ClN5 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 2-chloro-4-N-(quinolin-6-ylmethyl)pyrimidine-4,5-diamine |
| SMILES | Nc1cnc(Cl)nc1NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C14H12ClN5/c15-14-19-8-11(16)13(20-14)18-7-9-3-4-12-10(6-9)2-1-5-17-12/h1-6,8H,7,16H2,(H,18,19,20) |
| InChIKey | PMCMZUXDCLVXOH-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |