C23H23N5O2 — CID 139321368
6-[6-(2-methoxyethoxy)-3-pyridinyl]-2-N-(quinolin-6-ylmethyl)pyridine-2,3-diamine (PubChem CID 139321368) has the molecular formula C23H23N5O2 and a molecular weight of 401.47 g/mol. Its IUPAC name is 6-[6-(2-methoxyethoxy)-3-pyridinyl]-2-N-(quinolin-6-ylmethyl)pyridine-2,3-diamine.
| Compound Name | 6-[6-(2-methoxyethoxy)-3-pyridinyl]-2-N-(quinolin-6-ylmethyl)pyridine-2,3-diamine |
|---|---|
| PubChem CID | 139321368 |
| Molecular Formula | C23H23N5O2 |
| Molecular Weight | 401.47 g/mol |
| Exact Mass | 401.19 |
| IUPAC Name | 6-[6-(2-methoxyethoxy)-3-pyridinyl]-2-N-(quinolin-6-ylmethyl)pyridine-2,3-diamine |
| SMILES | COCCOc1ccc(-c2ccc(N)c(NCc3ccc4ncccc4c3)n2)cn1 |
| InChI | InChI=1S/C23H23N5O2/c1-29-11-12-30-22-9-5-18(15-26-22)21-8-6-19(24)23(28-21)27-14-16-4-7-20-17(13-16)3-2-10-25-20/h2-10,13,15H,11-12,14,24H2,1H3,(H,27,28) |
| InChIKey | RNBDYAJAZLRYQX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|