C22H22N8O2 — CID 139321349
3-diazenyl-6-N-[4-(2-methoxyethoxy)-3-pyridinyl]-2-N-(quinolin-6-ylmethyl)pyrazine-2,6-diamine (PubChem CID 139321349) has the molecular formula C22H22N8O2 and a molecular weight of 430.47 g/mol. Its IUPAC name is 3-diazenyl-6-N-[4-(2-methoxyethoxy)-3-pyridinyl]-2-N-(quinolin-6-ylmethyl)pyrazine-2,6-diamine.
| Compound Name | 3-diazenyl-6-N-[4-(2-methoxyethoxy)-3-pyridinyl]-2-N-(quinolin-6-ylmethyl)pyrazine-2,6-diamine |
|---|---|
| PubChem CID | 139321349 |
| Molecular Formula | C22H22N8O2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | 3-diazenyl-6-N-[4-(2-methoxyethoxy)-3-pyridinyl]-2-N-(quinolin-6-ylmethyl)pyrazine-2,6-diamine |
| SMILES | [H]/N=N/c1ncc(Nc2cnccc2OCCOC)nc1NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C22H22N8O2/c1-31-9-10-32-19-6-8-24-13-18(19)28-20-14-27-22(30-23)21(29-20)26-12-15-4-5-17-16(11-15)3-2-7-25-17/h2-8,11,13-14,23H,9-10,12H2,1H3,(H2,26,28,29)/b30-23+ |
| InChIKey | LYWHRWIBFCNABK-JJKYIXSRSA-N |
| XLogP | 4.46 |
| TPSA | 130.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|