C25H24N6O3 — CID 123969609
4-[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]-N-(2-hydroxyethoxy)-2-methylbenzamide (PubChem CID 123969609) has the molecular formula C25H24N6O3 and a molecular weight of 456.51 g/mol. Its IUPAC name is 4-[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]-N-(2-hydroxyethoxy)-2-methylbenzamide.
| Compound Name | 4-[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]-N-(2-hydroxyethoxy)-2-methylbenzamide |
|---|---|
| PubChem CID | 123969609 |
| Molecular Formula | C25H24N6O3 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 4-[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]-N-(2-hydroxyethoxy)-2-methylbenzamide |
| SMILES | [H]/N=N/c1ccc(-c2ccc(C(=O)NOCCO)c(C)c2)nc1NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C25H24N6O3/c1-16-13-19(5-6-20(16)25(33)31-34-12-11-32)22-8-9-23(30-26)24(29-22)28-15-17-4-7-21-18(14-17)3-2-10-27-21/h2-10,13-14,26,32H,11-12,15H2,1H3,(H,28,29)(H,31,33)/b30-26+ |
| InChIKey | UHLKLASJHWTZIS-URGPHPNLSA-N |
| XLogP | 4.53 |
| TPSA | 132.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|