C20H22N6O — CID 163885686
trans-(1R,2R)-2-[[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]amino]cyclopentan-1-ol (PubChem CID 163885686) has the molecular formula C20H22N6O and a molecular weight of 362.44 g/mol. Its IUPAC name is trans-(1R,2R)-2-[[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]amino]cyclopentan-1-ol.
| Compound Name | trans-(1R,2R)-2-[[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 163885686 |
| Molecular Formula | C20H22N6O |
| Molecular Weight | 362.44 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | trans-(1R,2R)-2-[[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]amino]cyclopentan-1-ol |
| SMILES | [H]/N=N/c1ccc(N[C@@H]2CCC[C@H]2O)nc1NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C20H22N6O/c21-26-17-8-9-19(24-16-4-1-5-18(16)27)25-20(17)23-12-13-6-7-15-14(11-13)3-2-10-22-15/h2-3,6-11,16,18,21,27H,1,4-5,12H2,(H2,23,24,25)/b26-21+/t16-,18-/m1/s1 |
| InChIKey | PXCUJNPZZKSOLL-FEJRMCNISA-N |
| XLogP | 4.23 |
| TPSA | 106.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|