C14H11BrN6 — CID 147859211
6-bromo-3-diazenyl-N-(quinolin-6-ylmethyl)pyrazin-2-amine (PubChem CID 147859211) has the molecular formula C14H11BrN6 and a molecular weight of 343.19 g/mol. Its IUPAC name is 6-bromo-3-diazenyl-N-(quinolin-6-ylmethyl)pyrazin-2-amine.
| Compound Name | 6-bromo-3-diazenyl-N-(quinolin-6-ylmethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 147859211 |
| Molecular Formula | C14H11BrN6 |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.02 |
| IUPAC Name | 6-bromo-3-diazenyl-N-(quinolin-6-ylmethyl)pyrazin-2-amine |
| SMILES | [H]/N=N/c1ncc(Br)nc1NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C14H11BrN6/c15-12-8-19-14(21-16)13(20-12)18-7-9-3-4-11-10(6-9)2-1-5-17-11/h1-6,8,16H,7H2,(H,18,20)/b21-16+ |
| InChIKey | HWINFPQVQAIERP-LTGZKZEYSA-N |
| XLogP | 4.06 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|