C26H24F2N6O3 — CID 123958809
4-[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]-2,6-difluoro-N-(2-hydroxy-2-methylpropoxy)benzamide (PubChem CID 123958809) has the molecular formula C26H24F2N6O3 and a molecular weight of 506.51 g/mol. Its IUPAC name is 4-[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]-2,6-difluoro-N-(2-hydroxy-2-methylpropoxy)benzamide.
| Compound Name | 4-[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]-2,6-difluoro-N-(2-hydroxy-2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 123958809 |
| Molecular Formula | C26H24F2N6O3 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.19 |
| IUPAC Name | 4-[5-diazenyl-6-(quinolin-6-ylmethylamino)-2-pyridinyl]-2,6-difluoro-N-(2-hydroxy-2-methylpropoxy)benzamide |
| SMILES | [H]/N=N/c1ccc(-c2cc(F)c(C(=O)NOCC(C)(C)O)c(F)c2)nc1NCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C26H24F2N6O3/c1-26(2,36)14-37-34-25(35)23-18(27)11-17(12-19(23)28)21-7-8-22(33-29)24(32-21)31-13-15-5-6-20-16(10-15)4-3-9-30-20/h3-12,29,36H,13-14H2,1-2H3,(H,31,32)(H,34,35)/b33-29+ |
| InChIKey | LSDZNRBWMIOYOF-XPXRSFDGSA-N |
| XLogP | 5.28 |
| TPSA | 132.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|