C24H17F2N5O2 — CID 71767340
2,6-difluoro-N-methoxy-4-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyridin-5-yl]benzamide (PubChem CID 71767340) has the molecular formula C24H17F2N5O2 and a molecular weight of 445.43 g/mol. Its IUPAC name is 2,6-difluoro-N-methoxy-4-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyridin-5-yl]benzamide.
| Compound Name | 2,6-difluoro-N-methoxy-4-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyridin-5-yl]benzamide |
|---|---|
| PubChem CID | 71767340 |
| Molecular Formula | C24H17F2N5O2 |
| Molecular Weight | 445.43 g/mol |
| Exact Mass | 445.14 |
| IUPAC Name | 2,6-difluoro-N-methoxy-4-[3-(quinolin-6-ylmethyl)imidazo[4,5-b]pyridin-5-yl]benzamide |
| SMILES | CONC(=O)c1c(F)cc(-c2ccc3ncn(Cc4ccc5ncccc5c4)c3n2)cc1F |
| InChI | InChI=1S/C24H17F2N5O2/c1-33-30-24(32)22-17(25)10-16(11-18(22)26)20-6-7-21-23(29-20)31(13-28-21)12-14-4-5-19-15(9-14)3-2-8-27-19/h2-11,13H,12H2,1H3,(H,30,32) |
| InChIKey | FDHFMWQPKRKYBH-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|