C22H19F2N3O — CID 143480962
6-(3,5-difluorophenyl)-2-(quinolin-6-ylmethyl)pyridazin-3-one;ethane (PubChem CID 143480962) has the molecular formula C22H19F2N3O and a molecular weight of 379.41 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-2-(quinolin-6-ylmethyl)pyridazin-3-one;ethane.
| Compound Name | 6-(3,5-difluorophenyl)-2-(quinolin-6-ylmethyl)pyridazin-3-one;ethane |
|---|---|
| PubChem CID | 143480962 |
| Molecular Formula | C22H19F2N3O |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 6-(3,5-difluorophenyl)-2-(quinolin-6-ylmethyl)pyridazin-3-one;ethane |
| SMILES | CC.O=c1ccc(-c2cc(F)cc(F)c2)nn1Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C20H13F2N3O.C2H6/c21-16-9-15(10-17(22)11-16)19-5-6-20(26)25(24-19)12-13-3-4-18-14(8-13)2-1-7-23-18;1-2/h1-11H,12H2;1-2H3 |
| InChIKey | PPENJMAGRCUMFS-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |