C19H19F2N3O — CID 143480951
2-[(3-aminophenyl)methyl]-6-(3,5-difluorophenyl)pyridazin-3-one;ethane (PubChem CID 143480951) has the molecular formula C19H19F2N3O and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-[(3-aminophenyl)methyl]-6-(3,5-difluorophenyl)pyridazin-3-one;ethane.
| Compound Name | 2-[(3-aminophenyl)methyl]-6-(3,5-difluorophenyl)pyridazin-3-one;ethane |
|---|---|
| PubChem CID | 143480951 |
| Molecular Formula | C19H19F2N3O |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-[(3-aminophenyl)methyl]-6-(3,5-difluorophenyl)pyridazin-3-one;ethane |
| SMILES | CC.Nc1cccc(Cn2nc(-c3cc(F)cc(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C17H13F2N3O.C2H6/c18-13-7-12(8-14(19)9-13)16-4-5-17(23)22(21-16)10-11-2-1-3-15(20)6-11;1-2/h1-9H,10,20H2;1-2H3 |
| InChIKey | XJLKMQUZXPMJOZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|