C27H33F2N5O2 — CID 143623684
2-[[3-[5-(butylamino)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-6-(3,5-difluorophenyl)pyridazin-3-one;ethane (PubChem CID 143623684) has the molecular formula C27H33F2N5O2 and a molecular weight of 497.59 g/mol. Its IUPAC name is 2-[[3-[5-(butylamino)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-6-(3,5-difluorophenyl)pyridazin-3-one;ethane.
| Compound Name | 2-[[3-[5-(butylamino)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-6-(3,5-difluorophenyl)pyridazin-3-one;ethane |
|---|---|
| PubChem CID | 143623684 |
| Molecular Formula | C27H33F2N5O2 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | 2-[[3-[5-(butylamino)-1,2,4-oxadiazol-3-yl]phenyl]methyl]-6-(3,5-difluorophenyl)pyridazin-3-one;ethane |
| SMILES | CC.CC.CCCCNc1nc(-c2cccc(Cn3nc(-c4cc(F)cc(F)c4)ccc3=O)c2)no1 |
| InChI | InChI=1S/C23H21F2N5O2.2C2H6/c1-2-3-9-26-23-27-22(29-32-23)16-6-4-5-15(10-16)14-30-21(31)8-7-20(28-30)17-11-18(24)13-19(25)12-17;2*1-2/h4-8,10-13H,2-3,9,14H2,1H3,(H,26,27,29);2*1-2H3 |
| InChIKey | XIHHKSXUFYEAGI-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|