C18H15F2N4O+ — CID 59484841
[amino-[3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]methylidene]azanium (PubChem CID 59484841) has the molecular formula C18H15F2N4O+ and a molecular weight of 341.34 g/mol. Its IUPAC name is [amino-[3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]methylidene]azanium.
| Compound Name | [amino-[3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]methylidene]azanium |
|---|---|
| PubChem CID | 59484841 |
| Molecular Formula | C18H15F2N4O+ |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | [amino-[3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]phenyl]methylidene]azanium |
| SMILES | NC(=[NH2+])c1cccc(Cn2nc(-c3cc(F)cc(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C18H14F2N4O/c19-14-7-13(8-15(20)9-14)16-4-5-17(25)24(23-16)10-11-2-1-3-12(6-11)18(21)22/h1-9H,10H2,(H3,21,22)/p+1 |
| InChIKey | XZBSYEQSNZKYDC-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|