C19H14F2N4O3 — CID 143623690
carbamoyl 3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]benzenecarboximidate (PubChem CID 143623690) has the molecular formula C19H14F2N4O3 and a molecular weight of 384.34 g/mol. Its IUPAC name is carbamoyl 3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]benzenecarboximidate.
| Compound Name | carbamoyl 3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]benzenecarboximidate |
|---|---|
| PubChem CID | 143623690 |
| Molecular Formula | C19H14F2N4O3 |
| Molecular Weight | 384.34 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | carbamoyl 3-[[3-(3,5-difluorophenyl)-6-oxopyridazin-1-yl]methyl]benzenecarboximidate |
| SMILES | [H]/N=C(\OC(N)=O)c1cccc(Cn2nc(-c3cc(F)cc(F)c3)ccc2=O)c1 |
| InChI | InChI=1S/C19H14F2N4O3/c20-14-7-13(8-15(21)9-14)16-4-5-17(26)25(24-16)10-11-2-1-3-12(6-11)18(22)28-19(23)27/h1-9,22H,10H2,(H2,23,27)/b22-18- |
| InChIKey | BYWCXXWKZORFJB-PYCFMQQDSA-N |
| XLogP | 2.66 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|