C21H15F2N5 — CID 143662623
6-(3,5-difluorophenyl)-2-(2-quinolin-6-ylethanimidoyl)pyridazin-3-imine (PubChem CID 143662623) has the molecular formula C21H15F2N5 and a molecular weight of 375.38 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-2-(2-quinolin-6-ylethanimidoyl)pyridazin-3-imine.
| Compound Name | 6-(3,5-difluorophenyl)-2-(2-quinolin-6-ylethanimidoyl)pyridazin-3-imine |
|---|---|
| PubChem CID | 143662623 |
| Molecular Formula | C21H15F2N5 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 6-(3,5-difluorophenyl)-2-(2-quinolin-6-ylethanimidoyl)pyridazin-3-imine |
| SMILES | [H]/N=C(/Cc1ccc2ncccc2c1)n1nc(-c2cc(F)cc(F)c2)cc/c1=N\[H] |
| InChI | InChI=1S/C21H15F2N5/c22-16-10-15(11-17(23)12-16)19-5-6-20(24)28(27-19)21(25)9-13-3-4-18-14(8-13)2-1-7-26-18/h1-8,10-12,24-25H,9H2/b24-20+,25-21- |
| InChIKey | ZRQHARXZQCCYFW-AIMKKSDKSA-N |
| XLogP | 3.92 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|