C30H30N8O2S2 — CID 154038457
bis[N-(2-quinolin-6-ylacetyl)carbamimidoyl] hexanediimidothioate (PubChem CID 154038457) has the molecular formula C30H30N8O2S2 and a molecular weight of 598.76 g/mol. Its IUPAC name is bis[N-(2-quinolin-6-ylacetyl)carbamimidoyl] hexanediimidothioate.
| Compound Name | bis[N-(2-quinolin-6-ylacetyl)carbamimidoyl] hexanediimidothioate |
|---|---|
| PubChem CID | 154038457 |
| Molecular Formula | C30H30N8O2S2 |
| Molecular Weight | 598.76 g/mol |
| Exact Mass | 598.19 |
| IUPAC Name | bis[N-(2-quinolin-6-ylacetyl)carbamimidoyl] hexanediimidothioate |
| SMILES | [H]/N=C(/CCCC/C(=N\[H])S/C(=N\[H])NC(=O)Cc1ccc2ncccc2c1)S/C(=N/[H])NC(=O)Cc1ccc2ncccc2c1 |
| InChI | InChI=1S/C30H30N8O2S2/c31-25(41-29(33)37-27(39)17-19-9-11-23-21(15-19)5-3-13-35-23)7-1-2-8-26(32)42-30(34)38-28(40)18-20-10-12-24-22(16-20)6-4-14-36-24/h3-6,9-16,31-32H,1-2,7-8,17-18H2,(H2,33,37,39)(H2,34,38,40)/b31-25-,32-26+ |
| InChIKey | PSPXITUOENAYFP-IEPGDLOPSA-N |
| XLogP | 5.65 |
| TPSA | 179.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.76 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|