C18H16N2O3S — CID 154848531
N-(3-methylsulfonylphenyl)-2-quinolin-6-ylacetamide (PubChem CID 154848531) has the molecular formula C18H16N2O3S and a molecular weight of 340.40 g/mol. Its IUPAC name is N-(3-methylsulfonylphenyl)-2-quinolin-6-ylacetamide.
| Compound Name | N-(3-methylsulfonylphenyl)-2-quinolin-6-ylacetamide |
|---|---|
| PubChem CID | 154848531 |
| Molecular Formula | C18H16N2O3S |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | N-(3-methylsulfonylphenyl)-2-quinolin-6-ylacetamide |
| SMILES | CS(=O)(=O)c1cccc(NC(=O)Cc2ccc3ncccc3c2)c1 |
| InChI | InChI=1S/C18H16N2O3S/c1-24(22,23)16-6-2-5-15(12-16)20-18(21)11-13-7-8-17-14(10-13)4-3-9-19-17/h2-10,12H,11H2,1H3,(H,20,21) |
| InChIKey | IXVLILQWOCRGIG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |