C29H35N5O6S2 — CID 157312354
[N-[2-(3,5-dimethoxyphenyl)acetyl]carbamimidoyl] 5-[5-[3-(3,5-dimethoxyphenyl)-2-oxopropyl]-1,3,4-thiadiazol-2-yl]pentanimidothioate (PubChem CID 157312354) has the molecular formula C29H35N5O6S2 and a molecular weight of 613.76 g/mol. Its IUPAC name is [N-[2-(3,5-dimethoxyphenyl)acetyl]carbamimidoyl] 5-[5-[3-(3,5-dimethoxyphenyl)-2-oxopropyl]-1,3,4-thiadiazol-2-yl]pentanimidothioate.
| Compound Name | [N-[2-(3,5-dimethoxyphenyl)acetyl]carbamimidoyl] 5-[5-[3-(3,5-dimethoxyphenyl)-2-oxopropyl]-1,3,4-thiadiazol-2-yl]pentanimidothioate |
|---|---|
| PubChem CID | 157312354 |
| Molecular Formula | C29H35N5O6S2 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | [N-[2-(3,5-dimethoxyphenyl)acetyl]carbamimidoyl] 5-[5-[3-(3,5-dimethoxyphenyl)-2-oxopropyl]-1,3,4-thiadiazol-2-yl]pentanimidothioate |
| SMILES | [H]/N=C(/NC(=O)Cc1cc(OC)cc(OC)c1)S/C(CCCCc1nnc(CC(=O)Cc2cc(OC)cc(OC)c2)s1)=N/[H] |
| InChI | InChI=1S/C29H35N5O6S2/c1-37-21-10-18(11-22(16-21)38-2)9-20(35)15-28-34-33-27(42-28)8-6-5-7-25(30)41-29(31)32-26(36)14-19-12-23(39-3)17-24(13-19)40-4/h10-13,16-17,30H,5-9,14-15H2,1-4H3,(H2,31,32,36)/b30-25+ |
| InChIKey | BDENAJYWQRFJFZ-QCWLDUFUSA-N |
| XLogP | 4.64 |
| TPSA | 156.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|