methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate

C8H12N2O3S — CID 54241391

IUPACmethyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate
SMILESCOC(=O)Cc1nnc(CCCO)s1
InChIInChI=1S/C8H12N2O3S/c1-13-8(12)5-7-10-9-6(14-7)3-2-4-11/h11H,2-5H2,1H3
InChIKeyFIGUHZKDBZBMCE-UHFFFAOYSA-N
MW216.26 g/mol
LogP0.18
Rot. Bonds5

About methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate

methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate (PubChem CID 54241391) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate.

Molecular Properties

Compound Namemethyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate
PubChem CID54241391
Molecular FormulaC8H12N2O3S
Molecular Weight216.26 g/mol
Exact Mass216.06
IUPAC Namemethyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate
SMILESCOC(=O)Cc1nnc(CCCO)s1
InChIInChI=1S/C8H12N2O3S/c1-13-8(12)5-7-10-9-6(14-7)3-2-4-11/h11H,2-5H2,1H3
InChIKeyFIGUHZKDBZBMCE-UHFFFAOYSA-N
XLogP0.18
TPSA72.31 Ų
H-Bond Donors1
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500216.26
LogP ≤ 50.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 106

Analyze methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate?
The IUPAC name of methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate (CID 54241391) is methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate.
What is the SMILES notation for methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate?
The canonical SMILES for methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate is COC(=O)Cc1nnc(CCCO)s1.
What is the InChIKey of methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate?
The InChIKey is FIGUHZKDBZBMCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O3S/c1-13-8(12)5-7-10-9-6(14-7)3-2-4-11/h11H,2-5H2,1H3.
What are the key properties of methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate?
methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate has a molecular weight of 216.26 g/mol, XLogP of 0.18, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[5-(3-hydroxypropyl)-1,3,4-thiadiazol-2-yl]acetate is sourced from PubChem (CID 54241391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).