C7H9N2O3S- — CID 22123164
5-(4-hydroxybutyl)-1,3,4-thiadiazole-2-carboxylate (PubChem CID 22123164) has the molecular formula C7H9N2O3S- and a molecular weight of 201.23 g/mol. Its IUPAC name is 5-(4-hydroxybutyl)-1,3,4-thiadiazole-2-carboxylate.
| Compound Name | 5-(4-hydroxybutyl)-1,3,4-thiadiazole-2-carboxylate |
|---|---|
| PubChem CID | 22123164 |
| Molecular Formula | C7H9N2O3S- |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.03 |
| IUPAC Name | 5-(4-hydroxybutyl)-1,3,4-thiadiazole-2-carboxylate |
| SMILES | O=C([O-])c1nnc(CCCCO)s1 |
| InChI | InChI=1S/C7H10N2O3S/c10-4-2-1-3-5-8-9-6(13-5)7(11)12/h10H,1-4H2,(H,11,12)/p-1 |
| InChIKey | VGIIUJGNIGOEFB-UHFFFAOYSA-M |
| XLogP | -0.78 |
| TPSA | 86.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|