C11H19BrN2S — CID 65426621
2-bromo-5-nonyl-1,3,4-thiadiazole (PubChem CID 65426621) has the molecular formula C11H19BrN2S and a molecular weight of 291.26 g/mol. Its IUPAC name is 2-bromo-5-nonyl-1,3,4-thiadiazole.
| Compound Name | 2-bromo-5-nonyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 65426621 |
| Molecular Formula | C11H19BrN2S |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-bromo-5-nonyl-1,3,4-thiadiazole |
| SMILES | CCCCCCCCCc1nnc(Br)s1 |
| InChI | InChI=1S/C11H19BrN2S/c1-2-3-4-5-6-7-8-9-10-13-14-11(12)15-10/h2-9H2,1H3 |
| InChIKey | YWHDNZGLWVDHCC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|