C13H25N3S — CID 114754233
N-[2-(5-hexyl-1,3,4-thiadiazol-2-yl)ethyl]propan-2-amine (PubChem CID 114754233) has the molecular formula C13H25N3S and a molecular weight of 255.43 g/mol. Its IUPAC name is N-[2-(5-hexyl-1,3,4-thiadiazol-2-yl)ethyl]propan-2-amine.
| Compound Name | N-[2-(5-hexyl-1,3,4-thiadiazol-2-yl)ethyl]propan-2-amine |
|---|---|
| PubChem CID | 114754233 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | N-[2-(5-hexyl-1,3,4-thiadiazol-2-yl)ethyl]propan-2-amine |
| SMILES | CCCCCCc1nnc(CCNC(C)C)s1 |
| InChI | InChI=1S/C13H25N3S/c1-4-5-6-7-8-12-15-16-13(17-12)9-10-14-11(2)3/h11,14H,4-10H2,1-3H3 |
| InChIKey | PAEWKESMKVGDBB-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|