About molecular hydrogen;N-propan-2-ylnonan-1-amine
molecular hydrogen;N-propan-2-ylnonan-1-amine (PubChem CID 166461486) has the molecular formula C12H29N
and a molecular weight of 187.37 g/mol. Its IUPAC name is molecular hydrogen;N-propan-2-ylnonan-1-amine.
Molecular Properties
| Compound Name | molecular hydrogen;N-propan-2-ylnonan-1-amine |
| PubChem CID | 166461486 |
| Molecular Formula | C12H29N |
| Molecular Weight | 187.37 g/mol |
| Exact Mass | 187.23 |
| IUPAC Name | molecular hydrogen;N-propan-2-ylnonan-1-amine |
| SMILES | CCCCCCCCCNC(C)C.[H][H] |
| InChI | InChI=1S/C12H27N.H2/c1-4-5-6-7-8-9-10-11-13-12(2)3;/h12-13H,4-11H2,1-3H3;1H |
| InChIKey | AYBCNYMJKSSDRQ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.37 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze molecular hydrogen;N-propan-2-ylnonan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;N-propan-2-ylnonan-1-amine?
The IUPAC name of molecular hydrogen;N-propan-2-ylnonan-1-amine (CID 166461486) is molecular hydrogen;N-propan-2-ylnonan-1-amine.
What is the SMILES notation for molecular hydrogen;N-propan-2-ylnonan-1-amine?
The canonical SMILES for molecular hydrogen;N-propan-2-ylnonan-1-amine is CCCCCCCCCNC(C)C.[H][H].
What is the InChIKey of molecular hydrogen;N-propan-2-ylnonan-1-amine?
The InChIKey is AYBCNYMJKSSDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.H2/c1-4-5-6-7-8-9-10-11-13-12(2)3;/h12-13H,4-11H2,1-3H3;1H.
What are the key properties of molecular hydrogen;N-propan-2-ylnonan-1-amine?
molecular hydrogen;N-propan-2-ylnonan-1-amine has a molecular weight of 187.37 g/mol, XLogP of 3.98, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-propan-2-ylnonan-1-amine is sourced from PubChem (CID 166461486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).