molecular hydrogen;N-propan-2-ylnonan-1-amine

C12H29N — CID 166461486

IUPACmolecular hydrogen;N-propan-2-ylnonan-1-amine
SMILESCCCCCCCCCNC(C)C.[H][H]
InChIInChI=1S/C12H27N.H2/c1-4-5-6-7-8-9-10-11-13-12(2)3;/h12-13H,4-11H2,1-3H3;1H
InChIKeyAYBCNYMJKSSDRQ-UHFFFAOYSA-N
MW187.37 g/mol
LogP3.98
Rot. Bonds9

About molecular hydrogen;N-propan-2-ylnonan-1-amine

molecular hydrogen;N-propan-2-ylnonan-1-amine (PubChem CID 166461486) has the molecular formula C12H29N and a molecular weight of 187.37 g/mol. Its IUPAC name is molecular hydrogen;N-propan-2-ylnonan-1-amine.

Molecular Properties

Compound Namemolecular hydrogen;N-propan-2-ylnonan-1-amine
PubChem CID166461486
Molecular FormulaC12H29N
Molecular Weight187.37 g/mol
Exact Mass187.23
IUPAC Namemolecular hydrogen;N-propan-2-ylnonan-1-amine
SMILESCCCCCCCCCNC(C)C.[H][H]
InChIInChI=1S/C12H27N.H2/c1-4-5-6-7-8-9-10-11-13-12(2)3;/h12-13H,4-11H2,1-3H3;1H
InChIKeyAYBCNYMJKSSDRQ-UHFFFAOYSA-N
XLogP3.98
TPSA12.03 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds9
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.37
LogP ≤ 53.98
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze molecular hydrogen;N-propan-2-ylnonan-1-amine with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of molecular hydrogen;N-propan-2-ylnonan-1-amine?
The IUPAC name of molecular hydrogen;N-propan-2-ylnonan-1-amine (CID 166461486) is molecular hydrogen;N-propan-2-ylnonan-1-amine.
What is the SMILES notation for molecular hydrogen;N-propan-2-ylnonan-1-amine?
The canonical SMILES for molecular hydrogen;N-propan-2-ylnonan-1-amine is CCCCCCCCCNC(C)C.[H][H].
What is the InChIKey of molecular hydrogen;N-propan-2-ylnonan-1-amine?
The InChIKey is AYBCNYMJKSSDRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27N.H2/c1-4-5-6-7-8-9-10-11-13-12(2)3;/h12-13H,4-11H2,1-3H3;1H.
What are the key properties of molecular hydrogen;N-propan-2-ylnonan-1-amine?
molecular hydrogen;N-propan-2-ylnonan-1-amine has a molecular weight of 187.37 g/mol, XLogP of 3.98, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;N-propan-2-ylnonan-1-amine is sourced from PubChem (CID 166461486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).