About octadecanoic acid;N-propan-2-ylpentadecan-1-amine
octadecanoic acid;N-propan-2-ylpentadecan-1-amine (PubChem CID 174971030) has the molecular formula C36H75NO2
and a molecular weight of 554.00 g/mol. Its IUPAC name is octadecanoic acid;N-propan-2-ylpentadecan-1-amine.
Molecular Properties
| Compound Name | octadecanoic acid;N-propan-2-ylpentadecan-1-amine |
| PubChem CID | 174971030 |
| Molecular Formula | C36H75NO2 |
| Molecular Weight | 554.00 g/mol |
| Exact Mass | 553.58 |
| IUPAC Name | octadecanoic acid;N-propan-2-ylpentadecan-1-amine |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCCNC(C)C |
| InChI | InChI=1S/C18H39N.C18H36O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-18(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h18-19H,4-17H2,1-3H3;2-17H2,1H3,(H,19,20) |
| InChIKey | XOQRKKIHABXWGA-UHFFFAOYSA-N |
| XLogP | 12.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 554.00 |
| LogP ≤ 5 | 12.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecanoic acid;N-propan-2-ylpentadecan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanoic acid;N-propan-2-ylpentadecan-1-amine?
The IUPAC name of octadecanoic acid;N-propan-2-ylpentadecan-1-amine (CID 174971030) is octadecanoic acid;N-propan-2-ylpentadecan-1-amine.
What is the SMILES notation for octadecanoic acid;N-propan-2-ylpentadecan-1-amine?
The canonical SMILES for octadecanoic acid;N-propan-2-ylpentadecan-1-amine is CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCCCCCCCCNC(C)C.
What is the InChIKey of octadecanoic acid;N-propan-2-ylpentadecan-1-amine?
The InChIKey is XOQRKKIHABXWGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H39N.C18H36O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19-18(2)3;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h18-19H,4-17H2,1-3H3;2-17H2,1H3,(H,19,20).
What are the key properties of octadecanoic acid;N-propan-2-ylpentadecan-1-amine?
octadecanoic acid;N-propan-2-ylpentadecan-1-amine has a molecular weight of 554.00 g/mol, XLogP of 12.41, 31 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanoic acid;N-propan-2-ylpentadecan-1-amine is sourced from PubChem (CID 174971030), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).