C10H18N2S — CID 139417384
2-heptyl-5-methyl-1,3,4-thiadiazole (PubChem CID 139417384) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 2-heptyl-5-methyl-1,3,4-thiadiazole.
| Compound Name | 2-heptyl-5-methyl-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 139417384 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 2-heptyl-5-methyl-1,3,4-thiadiazole |
| SMILES | CCCCCCCc1nnc(C)s1 |
| InChI | InChI=1S/C10H18N2S/c1-3-4-5-6-7-8-10-12-11-9(2)13-10/h3-8H2,1-2H3 |
| InChIKey | SZKFECCSPKBYPS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|