C14H26N2S4 — CID 88603492
2-dodecyl-5-(trisulfanyl)-1,3,4-thiadiazole (PubChem CID 88603492) has the molecular formula C14H26N2S4 and a molecular weight of 350.64 g/mol. Its IUPAC name is 2-dodecyl-5-(trisulfanyl)-1,3,4-thiadiazole.
| Compound Name | 2-dodecyl-5-(trisulfanyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 88603492 |
| Molecular Formula | C14H26N2S4 |
| Molecular Weight | 350.64 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2-dodecyl-5-(trisulfanyl)-1,3,4-thiadiazole |
| SMILES | CCCCCCCCCCCCc1nnc(SSS)s1 |
| InChI | InChI=1S/C14H26N2S4/c1-2-3-4-5-6-7-8-9-10-11-12-13-15-16-14(18-13)19-20-17/h17H,2-12H2,1H3 |
| InChIKey | OHUSLORAOPGLEV-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|