C22H42N2S5 — CID 22145197
2,5-bis(2-methylnonan-2-yldisulfanyl)-1,3,4-thiadiazole (PubChem CID 22145197) has the molecular formula C22H42N2S5 and a molecular weight of 494.93 g/mol. Its IUPAC name is 2,5-bis(2-methylnonan-2-yldisulfanyl)-1,3,4-thiadiazole.
| Compound Name | 2,5-bis(2-methylnonan-2-yldisulfanyl)-1,3,4-thiadiazole |
|---|---|
| PubChem CID | 22145197 |
| Molecular Formula | C22H42N2S5 |
| Molecular Weight | 494.93 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | 2,5-bis(2-methylnonan-2-yldisulfanyl)-1,3,4-thiadiazole |
| SMILES | CCCCCCCC(C)(C)SSc1nnc(SSC(C)(C)CCCCCCC)s1 |
| InChI | InChI=1S/C22H42N2S5/c1-7-9-11-13-15-17-21(3,4)28-26-19-23-24-20(25-19)27-29-22(5,6)18-16-14-12-10-8-2/h7-18H2,1-6H3 |
| InChIKey | AHWWPDKYKKQMOX-UHFFFAOYSA-N |
| XLogP | 10.30 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.93 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|