C20H40N2S5 — CID 87836008
2,5-bis(2-methyloctan-2-yldisulfanyl)-3H-1,2,4-thiadiazole (PubChem CID 87836008) has the molecular formula C20H40N2S5 and a molecular weight of 468.89 g/mol. Its IUPAC name is 2,5-bis(2-methyloctan-2-yldisulfanyl)-3H-1,2,4-thiadiazole.
| Compound Name | 2,5-bis(2-methyloctan-2-yldisulfanyl)-3H-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 87836008 |
| Molecular Formula | C20H40N2S5 |
| Molecular Weight | 468.89 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 2,5-bis(2-methyloctan-2-yldisulfanyl)-3H-1,2,4-thiadiazole |
| SMILES | CCCCCCC(C)(C)SSC1=NCN(SSC(C)(C)CCCCCC)S1 |
| InChI | InChI=1S/C20H40N2S5/c1-7-9-11-13-15-19(3,4)25-24-18-21-17-22(23-18)27-26-20(5,6)16-14-12-10-8-2/h7-17H2,1-6H3 |
| InChIKey | ZDOJFXNZJMHICO-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.89 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|