C11H21N3S — CID 3866264
5-nonyl-1,3,4-thiadiazol-2-amine (PubChem CID 3866264) has the molecular formula C11H21N3S and a molecular weight of 227.38 g/mol. Its IUPAC name is 5-nonyl-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-nonyl-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 3866264 |
| Molecular Formula | C11H21N3S |
| Molecular Weight | 227.38 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 5-nonyl-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCCCCCCc1nnc(N)s1 |
| InChI | InChI=1S/C11H21N3S/c1-2-3-4-5-6-7-8-9-10-13-14-11(12)15-10/h2-9H2,1H3,(H2,12,14) |
| InChIKey | UXGCJGDBDKTWID-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|