C10H19N3OS — CID 80609028
5-(heptoxymethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 80609028) has the molecular formula C10H19N3OS and a molecular weight of 229.35 g/mol. Its IUPAC name is 5-(heptoxymethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(heptoxymethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80609028 |
| Molecular Formula | C10H19N3OS |
| Molecular Weight | 229.35 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | 5-(heptoxymethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCCCCOCc1nnc(N)s1 |
| InChI | InChI=1S/C10H19N3OS/c1-2-3-4-5-6-7-14-8-9-12-13-10(11)15-9/h2-8H2,1H3,(H2,11,13) |
| InChIKey | LXVDYNXUARWHPZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|