C8H13N3OS2 — CID 141438698
O-butyl 2-(5-amino-1,3,4-thiadiazol-2-yl)ethanethioate (PubChem CID 141438698) has the molecular formula C8H13N3OS2 and a molecular weight of 231.35 g/mol. Its IUPAC name is O-butyl 2-(5-amino-1,3,4-thiadiazol-2-yl)ethanethioate.
| Compound Name | O-butyl 2-(5-amino-1,3,4-thiadiazol-2-yl)ethanethioate |
|---|---|
| PubChem CID | 141438698 |
| Molecular Formula | C8H13N3OS2 |
| Molecular Weight | 231.35 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | O-butyl 2-(5-amino-1,3,4-thiadiazol-2-yl)ethanethioate |
| SMILES | CCCCOC(=S)Cc1nnc(N)s1 |
| InChI | InChI=1S/C8H13N3OS2/c1-2-3-4-12-7(13)5-6-10-11-8(9)14-6/h2-5H2,1H3,(H2,9,11) |
| InChIKey | SAPYINBXAVUDKK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|