C9H17N3OS — CID 80608321
5-(hexoxymethyl)-1,3,4-thiadiazol-2-amine (PubChem CID 80608321) has the molecular formula C9H17N3OS and a molecular weight of 215.32 g/mol. Its IUPAC name is 5-(hexoxymethyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(hexoxymethyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 80608321 |
| Molecular Formula | C9H17N3OS |
| Molecular Weight | 215.32 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 5-(hexoxymethyl)-1,3,4-thiadiazol-2-amine |
| SMILES | CCCCCCOCc1nnc(N)s1 |
| InChI | InChI=1S/C9H17N3OS/c1-2-3-4-5-6-13-7-8-11-12-9(10)14-8/h2-7H2,1H3,(H2,10,12) |
| InChIKey | HHILUUFWIMZTOH-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|