C7H11N3OS2 — CID 15681566
6-amino-4-butoxy-1,3,5-thiadiazine-2-thione (PubChem CID 15681566) has the molecular formula C7H11N3OS2 and a molecular weight of 217.32 g/mol. Its IUPAC name is 6-amino-4-butoxy-1,3,5-thiadiazine-2-thione.
| Compound Name | 6-amino-4-butoxy-1,3,5-thiadiazine-2-thione |
|---|---|
| PubChem CID | 15681566 |
| Molecular Formula | C7H11N3OS2 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 6-amino-4-butoxy-1,3,5-thiadiazine-2-thione |
| SMILES | CCCCOc1nc(N)sc(=S)n1 |
| InChI | InChI=1S/C7H11N3OS2/c1-2-3-4-11-6-9-5(8)13-7(12)10-6/h2-4H2,1H3,(H2,8,9,10,12) |
| InChIKey | PZEGOWCXNAUPNU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|