C10H13ClN4O — CID 146188042
2-butoxy-6-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 146188042) has the molecular formula C10H13ClN4O and a molecular weight of 240.69 g/mol. Its IUPAC name is 2-butoxy-6-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-butoxy-6-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146188042 |
| Molecular Formula | C10H13ClN4O |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | 2-butoxy-6-chloro-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCCCOc1nc(N)c2cc(Cl)[nH]c2n1 |
| InChI | InChI=1S/C10H13ClN4O/c1-2-3-4-16-10-14-8(12)6-5-7(11)13-9(6)15-10/h5H,2-4H2,1H3,(H3,12,13,14,15) |
| InChIKey | KKHVUKWMVZSMNO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|