C9H14N5O+ — CID 123806555
2-butoxy-7H-purin-9-ium-6-amine (PubChem CID 123806555) has the molecular formula C9H14N5O+ and a molecular weight of 208.25 g/mol. Its IUPAC name is 2-butoxy-7H-purin-9-ium-6-amine.
| Compound Name | 2-butoxy-7H-purin-9-ium-6-amine |
|---|---|
| PubChem CID | 123806555 |
| Molecular Formula | C9H14N5O+ |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-butoxy-7H-purin-9-ium-6-amine |
| SMILES | CCCCOc1nc(N)c2[nH]c[nH+]c2n1 |
| InChI | InChI=1S/C9H13N5O/c1-2-3-4-15-9-13-7(10)6-8(14-9)12-5-11-6/h5H,2-4H2,1H3,(H3,10,11,12,13,14)/p+1 |
| InChIKey | HVEGYOGEXMRFKF-UHFFFAOYSA-O |
| XLogP | 0.53 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|